raaeraae22
raaeraae22
04-02-2017
Chemistry
contestada
When is di- used in the name of a hydrocarbon?
Respuesta :
DoctorCass
DoctorCass
04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link
VER TODAS LAS RESPUESTAS ( 94+ )
Otras preguntas
PLEASE HELP THERE ARE TWO SCENARIOSScenario ACollege graduates are moving back in with family in record numbers. They are waiting longer than previous generatio
A closed box with a square base is to have a volume of 16000 cubic centimeters. The material for the top and bottom of the box costs $3 per square centimeter
Which of the following is an example of voluntary debt - that is, debt a person or business creates in good faith and not under duress? A. Mortgage B. All of th
What is the goal of managers who use matrix analysis to evaluate menu items based on each item's popularity and food cost percentage?
What is the frequency of a photon that has the same momentum as a neutron moving with a speed of 1400 m/s?
given that sinθ=-3/4 in quadrant 4 find cosθ
Alice and Bob are currently 1000 feet apart and are both running directly toward each other at a constant speed of 10 feet per second. A bird starts in the same
Which behavior can reduce ones risk of acquiring a sexually transmitted infection
Consider the given statement. If it is not Monday, then there are students in the gym. For each statement below, determine whether it is equivalent to the given
In the electron transport chain, protons are pumped from where to where in the mitochondria of eukaryotic cells?
